C15H17NO5 — CID 15043278
1-O-benzyl 3-O-ethyl 4-oxopyrrolidine-1,3-dicarboxylate (PubChem CID 15043278) has the molecular formula C15H17NO5 and a molecular weight of 291.30 g/mol. Its IUPAC name is 1-O-benzyl 3-O-ethyl 4-oxopyrrolidine-1,3-dicarboxylate.
| Compound Name | 1-O-benzyl 3-O-ethyl 4-oxopyrrolidine-1,3-dicarboxylate |
|---|---|
| PubChem CID | 15043278 |
| Molecular Formula | C15H17NO5 |
| Molecular Weight | 291.30 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | 1-O-benzyl 3-O-ethyl 4-oxopyrrolidine-1,3-dicarboxylate |
| SMILES | CCOC(=O)C1CN(C(=O)OCc2ccccc2)CC1=O |
| InChI | InChI=1S/C15H17NO5/c1-2-20-14(18)12-8-16(9-13(12)17)15(19)21-10-11-6-4-3-5-7-11/h3-7,12H,2,8-10H2,1H3 |
| InChIKey | FRNZCPLVDNHRIH-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.30 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|