C27H27N5O2S — CID 150433677
2-[[(1S,3S,5S)-2-[5-(3,4-dimethylphenyl)-2-methyl-1,3-thiazole-4-carbonyl]-2-azabicyclo[3.1.0]hexan-3-yl]methyl]imidazo[1,2-a]pyridine-3-carboxamide (PubChem CID 150433677) has the molecular formula C27H27N5O2S and a molecular weight of 485.61 g/mol. Its IUPAC name is 2-[[(1S,3S,5S)-2-[5-(3,4-dimethylphenyl)-2-methyl-1,3-thiazole-4-carbonyl]-2-azabicyclo[3.1.0]hexan-3-yl]methyl]imidazo[1,2-a]pyridine-3-carboxamide.
| Compound Name | 2-[[(1S,3S,5S)-2-[5-(3,4-dimethylphenyl)-2-methyl-1,3-thiazole-4-carbonyl]-2-azabicyclo[3.1.0]hexan-3-yl]methyl]imidazo[1,2-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 150433677 |
| Molecular Formula | C27H27N5O2S |
| Molecular Weight | 485.61 g/mol |
| Exact Mass | 485.19 |
| IUPAC Name | 2-[[(1S,3S,5S)-2-[5-(3,4-dimethylphenyl)-2-methyl-1,3-thiazole-4-carbonyl]-2-azabicyclo[3.1.0]hexan-3-yl]methyl]imidazo[1,2-a]pyridine-3-carboxamide |
| SMILES | Cc1nc(C(=O)N2[C@H](Cc3nc4ccccn4c3C(N)=O)C[C@@H]3C[C@@H]32)c(-c2ccc(C)c(C)c2)s1 |
| InChI | InChI=1S/C27H27N5O2S/c1-14-7-8-17(10-15(14)2)25-23(29-16(3)35-25)27(34)32-19(11-18-12-21(18)32)13-20-24(26(28)33)31-9-5-4-6-22(31)30-20/h4-10,18-19,21H,11-13H2,1-3H3,(H2,28,33)/t18-,19+,21+/m1/s1 |
| InChIKey | HKHNTCXVVMZWFK-DYXWJJEUSA-N |
| XLogP | 4.33 |
| TPSA | 93.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.61 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |