C21H20N4OS — CID 134207730
5-amino-N-(2,3-dihydro-1H-inden-2-yl)-7,11-dimethyl-3-thia-1,10-diazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaene-4-carboxamide (PubChem CID 134207730) has the molecular formula C21H20N4OS and a molecular weight of 376.49 g/mol. Its IUPAC name is 5-amino-N-(2,3-dihydro-1H-inden-2-yl)-7,11-dimethyl-3-thia-1,10-diazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaene-4-carboxamide.
| Compound Name | 5-amino-N-(2,3-dihydro-1H-inden-2-yl)-7,11-dimethyl-3-thia-1,10-diazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaene-4-carboxamide |
|---|---|
| PubChem CID | 134207730 |
| Molecular Formula | C21H20N4OS |
| Molecular Weight | 376.49 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | 5-amino-N-(2,3-dihydro-1H-inden-2-yl)-7,11-dimethyl-3-thia-1,10-diazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaene-4-carboxamide |
| SMILES | Cc1cn2c(cc(C)c3c(N)c(C(=O)NC4Cc5ccccc5C4)sc32)n1 |
| InChI | InChI=1S/C21H20N4OS/c1-11-7-16-23-12(2)10-25(16)21-17(11)18(22)19(27-21)20(26)24-15-8-13-5-3-4-6-14(13)9-15/h3-7,10,15H,8-9,22H2,1-2H3,(H,24,26) |
| InChIKey | QXMQOGZXBQTXFS-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 72.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.49 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |