C19H36O — CID 150438114
10,10-dimethyl-1-(3-methylpent-1-yn-3-yloxy)undecane (PubChem CID 150438114) has the molecular formula C19H36O and a molecular weight of 280.50 g/mol. Its IUPAC name is 10,10-dimethyl-1-(3-methylpent-1-yn-3-yloxy)undecane.
| Compound Name | 10,10-dimethyl-1-(3-methylpent-1-yn-3-yloxy)undecane |
|---|---|
| PubChem CID | 150438114 |
| Molecular Formula | C19H36O |
| Molecular Weight | 280.50 g/mol |
| Exact Mass | 280.28 |
| IUPAC Name | 10,10-dimethyl-1-(3-methylpent-1-yn-3-yloxy)undecane |
| SMILES | C#CC(C)(CC)OCCCCCCCCCC(C)(C)C |
| InChI | InChI=1S/C19H36O/c1-7-19(6,8-2)20-17-15-13-11-9-10-12-14-16-18(3,4)5/h1H,8-17H2,2-6H3 |
| InChIKey | HLESVOAIIXEUFN-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.50 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|