C27H23F5N6O — CID 150440358
1-[6-[(1R)-2-(2,5-difluorophenyl)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl]imidazo[1,2-b]pyridazin-3-yl]-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 150440358) has the molecular formula C27H23F5N6O and a molecular weight of 542.51 g/mol. Its IUPAC name is 1-[6-[(1R)-2-(2,5-difluorophenyl)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl]imidazo[1,2-b]pyridazin-3-yl]-3-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[6-[(1R)-2-(2,5-difluorophenyl)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl]imidazo[1,2-b]pyridazin-3-yl]-3-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 150440358 |
| Molecular Formula | C27H23F5N6O |
| Molecular Weight | 542.51 g/mol |
| Exact Mass | 542.19 |
| IUPAC Name | 1-[6-[(1R)-2-(2,5-difluorophenyl)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl]imidazo[1,2-b]pyridazin-3-yl]-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | O=C(Nc1cccc(C(F)(F)F)c1)Nc1cnc2ccc([C@@H]3C(c4cc(F)ccc4F)CN4CCCC34)nn12 |
| InChI | InChI=1S/C27H23F5N6O/c28-16-6-7-20(29)18(12-16)19-14-37-10-2-5-22(37)25(19)21-8-9-23-33-13-24(38(23)36-21)35-26(39)34-17-4-1-3-15(11-17)27(30,31)32/h1,3-4,6-9,11-13,19,22,25H,2,5,10,14H2,(H2,34,35,39)/t19?,22?,25-/m0/s1 |
| InChIKey | HLQJMVHTAAHYBE-KRFYGZOHSA-N |
| XLogP | 6.02 |
| TPSA | 74.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.51 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |