C17H20N2O3 — CID 15044372
2-[4-[[(2S,3S)-3-butyloxiran-2-yl]methoxy]phenyl]pyrimidin-5-ol (PubChem CID 15044372) has the molecular formula C17H20N2O3 and a molecular weight of 300.36 g/mol. Its IUPAC name is 2-[4-[[(2S,3S)-3-butyloxiran-2-yl]methoxy]phenyl]pyrimidin-5-ol.
| Compound Name | 2-[4-[[(2S,3S)-3-butyloxiran-2-yl]methoxy]phenyl]pyrimidin-5-ol |
|---|---|
| PubChem CID | 15044372 |
| Molecular Formula | C17H20N2O3 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | 2-[4-[[(2S,3S)-3-butyloxiran-2-yl]methoxy]phenyl]pyrimidin-5-ol |
| SMILES | CCCC[C@@H]1O[C@H]1COc1ccc(-c2ncc(O)cn2)cc1 |
| InChI | InChI=1S/C17H20N2O3/c1-2-3-4-15-16(22-15)11-21-14-7-5-12(6-8-14)17-18-9-13(20)10-19-17/h5-10,15-16,20H,2-4,11H2,1H3/t15-,16-/m0/s1 |
| InChIKey | BMKYMTNRORWQDX-HOTGVXAUSA-N |
| XLogP | 3.19 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|