C26H30N2O3 — CID 57226585
5-[4-[[(2S,3S)-3-butyloxiran-2-yl]methoxy]phenyl]-2-(3-propoxyphenyl)pyrimidine (PubChem CID 57226585) has the molecular formula C26H30N2O3 and a molecular weight of 418.54 g/mol. Its IUPAC name is 5-[4-[[(2S,3S)-3-butyloxiran-2-yl]methoxy]phenyl]-2-(3-propoxyphenyl)pyrimidine.
| Compound Name | 5-[4-[[(2S,3S)-3-butyloxiran-2-yl]methoxy]phenyl]-2-(3-propoxyphenyl)pyrimidine |
|---|---|
| PubChem CID | 57226585 |
| Molecular Formula | C26H30N2O3 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.23 |
| IUPAC Name | 5-[4-[[(2S,3S)-3-butyloxiran-2-yl]methoxy]phenyl]-2-(3-propoxyphenyl)pyrimidine |
| SMILES | CCCC[C@@H]1O[C@H]1COc1ccc(-c2cnc(-c3cccc(OCCC)c3)nc2)cc1 |
| InChI | InChI=1S/C26H30N2O3/c1-3-5-9-24-25(31-24)18-30-22-12-10-19(11-13-22)21-16-27-26(28-17-21)20-7-6-8-23(15-20)29-14-4-2/h6-8,10-13,15-17,24-25H,3-5,9,14,18H2,1-2H3/t24-,25-/m0/s1 |
| InChIKey | VYFZDULFWGEJPG-DQEYMECFSA-N |
| XLogP | 5.94 |
| TPSA | 56.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|