C24H35N3O3 — CID 19389357
5-[(3-butyloxiran-2-yl)methoxy]-2-(6-octoxy-3-pyridinyl)pyrimidine (PubChem CID 19389357) has the molecular formula C24H35N3O3 and a molecular weight of 413.56 g/mol. Its IUPAC name is 5-[(3-butyloxiran-2-yl)methoxy]-2-(6-octoxy-3-pyridinyl)pyrimidine.
| Compound Name | 5-[(3-butyloxiran-2-yl)methoxy]-2-(6-octoxy-3-pyridinyl)pyrimidine |
|---|---|
| PubChem CID | 19389357 |
| Molecular Formula | C24H35N3O3 |
| Molecular Weight | 413.56 g/mol |
| Exact Mass | 413.27 |
| IUPAC Name | 5-[(3-butyloxiran-2-yl)methoxy]-2-(6-octoxy-3-pyridinyl)pyrimidine |
| SMILES | CCCCCCCCOc1ccc(-c2ncc(OCC3OC3CCCC)cn2)cn1 |
| InChI | InChI=1S/C24H35N3O3/c1-3-5-7-8-9-10-14-28-23-13-12-19(15-25-23)24-26-16-20(17-27-24)29-18-22-21(30-22)11-6-4-2/h12-13,15-17,21-22H,3-11,14,18H2,1-2H3 |
| InChIKey | BXRMNFYZPWHJBI-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 69.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.56 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|