C20H26N4O3 — CID 150445685
tert-butyl-[2-(methylamino)-1-[4-(pyridin-4-ylcarbamoyl)phenyl]ethyl]carbamic acid (PubChem CID 150445685) has the molecular formula C20H26N4O3 and a molecular weight of 370.45 g/mol. Its IUPAC name is tert-butyl-[2-(methylamino)-1-[4-(pyridin-4-ylcarbamoyl)phenyl]ethyl]carbamic acid.
| Compound Name | tert-butyl-[2-(methylamino)-1-[4-(pyridin-4-ylcarbamoyl)phenyl]ethyl]carbamic acid |
|---|---|
| PubChem CID | 150445685 |
| Molecular Formula | C20H26N4O3 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | tert-butyl-[2-(methylamino)-1-[4-(pyridin-4-ylcarbamoyl)phenyl]ethyl]carbamic acid |
| SMILES | CNCC(c1ccc(C(=O)Nc2ccncc2)cc1)N(C(=O)O)C(C)(C)C |
| InChI | InChI=1S/C20H26N4O3/c1-20(2,3)24(19(26)27)17(13-21-4)14-5-7-15(8-6-14)18(25)23-16-9-11-22-12-10-16/h5-12,17,21H,13H2,1-4H3,(H,26,27)(H,22,23,25) |
| InChIKey | HMSGNTZWNKJBLD-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |