C19H24N4O3 — CID 59419420
tert-butyl N-[2-amino-1-[4-(pyridin-4-ylcarbamoyl)phenyl]ethyl]carbamate (PubChem CID 59419420) has the molecular formula C19H24N4O3 and a molecular weight of 356.43 g/mol. Its IUPAC name is tert-butyl N-[2-amino-1-[4-(pyridin-4-ylcarbamoyl)phenyl]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-amino-1-[4-(pyridin-4-ylcarbamoyl)phenyl]ethyl]carbamate |
|---|---|
| PubChem CID | 59419420 |
| Molecular Formula | C19H24N4O3 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | tert-butyl N-[2-amino-1-[4-(pyridin-4-ylcarbamoyl)phenyl]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(CN)c1ccc(C(=O)Nc2ccncc2)cc1 |
| InChI | InChI=1S/C19H24N4O3/c1-19(2,3)26-18(25)23-16(12-20)13-4-6-14(7-5-13)17(24)22-15-8-10-21-11-9-15/h4-11,16H,12,20H2,1-3H3,(H,23,25)(H,21,22,24) |
| InChIKey | GYDBNHXRMLQFEG-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |