C19H24N4O3 — CID 68668186
tert-butyl N-amino-N-[2-[4-(pyridin-4-ylcarbamoyl)phenyl]ethyl]carbamate (PubChem CID 68668186) has the molecular formula C19H24N4O3 and a molecular weight of 356.43 g/mol. Its IUPAC name is tert-butyl N-amino-N-[2-[4-(pyridin-4-ylcarbamoyl)phenyl]ethyl]carbamate.
| Compound Name | tert-butyl N-amino-N-[2-[4-(pyridin-4-ylcarbamoyl)phenyl]ethyl]carbamate |
|---|---|
| PubChem CID | 68668186 |
| Molecular Formula | C19H24N4O3 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | tert-butyl N-amino-N-[2-[4-(pyridin-4-ylcarbamoyl)phenyl]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(N)CCc1ccc(C(=O)Nc2ccncc2)cc1 |
| InChI | InChI=1S/C19H24N4O3/c1-19(2,3)26-18(25)23(20)13-10-14-4-6-15(7-5-14)17(24)22-16-8-11-21-12-9-16/h4-9,11-12H,10,13,20H2,1-3H3,(H,21,22,24) |
| InChIKey | HEOGZHDRMDXXAQ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 97.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|