C17H17F3O3 — CID 150451231
2-(ethoxymethyl)-4,4,4-trifluoro-3-naphthalen-1-ylbutanoic acid (PubChem CID 150451231) has the molecular formula C17H17F3O3 and a molecular weight of 326.31 g/mol. Its IUPAC name is 2-(ethoxymethyl)-4,4,4-trifluoro-3-naphthalen-1-ylbutanoic acid.
| Compound Name | 2-(ethoxymethyl)-4,4,4-trifluoro-3-naphthalen-1-ylbutanoic acid |
|---|---|
| PubChem CID | 150451231 |
| Molecular Formula | C17H17F3O3 |
| Molecular Weight | 326.31 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | 2-(ethoxymethyl)-4,4,4-trifluoro-3-naphthalen-1-ylbutanoic acid |
| SMILES | CCOCC(C(=O)O)C(c1cccc2ccccc12)C(F)(F)F |
| InChI | InChI=1S/C17H17F3O3/c1-2-23-10-14(16(21)22)15(17(18,19)20)13-9-5-7-11-6-3-4-8-12(11)13/h3-9,14-15H,2,10H2,1H3,(H,21,22) |
| InChIKey | HNVPWPSXEISBJL-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.31 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |