C18H25BrO2S — CID 15046040
2-bromo-1-cyclohexyl-2-(4-methylphenyl)sulfinylpentan-1-one (PubChem CID 15046040) has the molecular formula C18H25BrO2S and a molecular weight of 385.37 g/mol. Its IUPAC name is 2-bromo-1-cyclohexyl-2-(4-methylphenyl)sulfinylpentan-1-one.
| Compound Name | 2-bromo-1-cyclohexyl-2-(4-methylphenyl)sulfinylpentan-1-one |
|---|---|
| PubChem CID | 15046040 |
| Molecular Formula | C18H25BrO2S |
| Molecular Weight | 385.37 g/mol |
| Exact Mass | 384.08 |
| IUPAC Name | 2-bromo-1-cyclohexyl-2-(4-methylphenyl)sulfinylpentan-1-one |
| SMILES | CCCC(Br)(C(=O)C1CCCCC1)S(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C18H25BrO2S/c1-3-13-18(19,17(20)15-7-5-4-6-8-15)22(21)16-11-9-14(2)10-12-16/h9-12,15H,3-8,13H2,1-2H3 |
| InChIKey | ZVBQTMUVFVLTIU-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.37 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|