About butane;1-(4-cyclohexylcyclohexyl)ethanone;1-cyclohexyl-4-methylbenzene
butane;1-(4-cyclohexylcyclohexyl)ethanone;1-cyclohexyl-4-methylbenzene (PubChem CID 145386737) has the molecular formula C31H52O
and a molecular weight of 440.76 g/mol. Its IUPAC name is butane;1-(4-cyclohexylcyclohexyl)ethanone;1-cyclohexyl-4-methylbenzene.
Molecular Properties
| Compound Name | butane;1-(4-cyclohexylcyclohexyl)ethanone;1-cyclohexyl-4-methylbenzene |
| PubChem CID | 145386737 |
| Molecular Formula | C31H52O |
| Molecular Weight | 440.76 g/mol |
| Exact Mass | 440.40 |
| IUPAC Name | butane;1-(4-cyclohexylcyclohexyl)ethanone;1-cyclohexyl-4-methylbenzene |
| SMILES | CC(=O)C1CCC(C2CCCCC2)CC1.CCCC.Cc1ccc(C2CCCCC2)cc1 |
| InChI | InChI=1S/C14H24O.C13H18.C4H10/c1-11(15)12-7-9-14(10-8-12)13-5-3-2-4-6-13;1-11-7-9-13(10-8-11)12-5-3-2-4-6-12;1-3-4-2/h12-14H,2-10H2,1H3;7-10,12H,2-6H2,1H3;3-4H2,1-2H3 |
| InChIKey | PXHPODNRLCHRRY-UHFFFAOYSA-N |
| XLogP | 9.81 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 440.76 |
| LogP ≤ 5 | 9.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze butane;1-(4-cyclohexylcyclohexyl)ethanone;1-cyclohexyl-4-methylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane;1-(4-cyclohexylcyclohexyl)ethanone;1-cyclohexyl-4-methylbenzene?
The IUPAC name of butane;1-(4-cyclohexylcyclohexyl)ethanone;1-cyclohexyl-4-methylbenzene (CID 145386737) is butane;1-(4-cyclohexylcyclohexyl)ethanone;1-cyclohexyl-4-methylbenzene.
What is the SMILES notation for butane;1-(4-cyclohexylcyclohexyl)ethanone;1-cyclohexyl-4-methylbenzene?
The canonical SMILES for butane;1-(4-cyclohexylcyclohexyl)ethanone;1-cyclohexyl-4-methylbenzene is CC(=O)C1CCC(C2CCCCC2)CC1.CCCC.Cc1ccc(C2CCCCC2)cc1.
What is the InChIKey of butane;1-(4-cyclohexylcyclohexyl)ethanone;1-cyclohexyl-4-methylbenzene?
The InChIKey is PXHPODNRLCHRRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24O.C13H18.C4H10/c1-11(15)12-7-9-14(10-8-12)13-5-3-2-4-6-13;1-11-7-9-13(10-8-11)12-5-3-2-4-6-12;1-3-4-2/h12-14H,2-10H2,1H3;7-10,12H,2-6H2,1H3;3-4H2,1-2H3.
What are the key properties of butane;1-(4-cyclohexylcyclohexyl)ethanone;1-cyclohexyl-4-methylbenzene?
butane;1-(4-cyclohexylcyclohexyl)ethanone;1-cyclohexyl-4-methylbenzene has a molecular weight of 440.76 g/mol, XLogP of 9.81, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for butane;1-(4-cyclohexylcyclohexyl)ethanone;1-cyclohexyl-4-methylbenzene is sourced from PubChem (CID 145386737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).