C31H52O — CID 145386737
butane;1-(4-cyclohexylcyclohexyl)ethanone;1-cyclohexyl-4-methylbenzene (PubChem CID 145386737) has the molecular formula C31H52O and a molecular weight of 440.76 g/mol. Its IUPAC name is butane;1-(4-cyclohexylcyclohexyl)ethanone;1-cyclohexyl-4-methylbenzene.
| Compound Name | butane;1-(4-cyclohexylcyclohexyl)ethanone;1-cyclohexyl-4-methylbenzene |
|---|---|
| PubChem CID | 145386737 |
| Molecular Formula | C31H52O |
| Molecular Weight | 440.76 g/mol |
| Exact Mass | 440.40 |
| IUPAC Name | butane;1-(4-cyclohexylcyclohexyl)ethanone;1-cyclohexyl-4-methylbenzene |
| SMILES | CC(=O)C1CCC(C2CCCCC2)CC1.CCCC.Cc1ccc(C2CCCCC2)cc1 |
| InChI | InChI=1S/C14H24O.C13H18.C4H10/c1-11(15)12-7-9-14(10-8-12)13-5-3-2-4-6-13;1-11-7-9-13(10-8-11)12-5-3-2-4-6-12;1-3-4-2/h12-14H,2-10H2,1H3;7-10,12H,2-6H2,1H3;3-4H2,1-2H3 |
| InChIKey | PXHPODNRLCHRRY-UHFFFAOYSA-N |
| XLogP | 9.81 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.76 |
| LogP ≤ 5 | 9.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |