C26H38O2 — CID 70004413
2-methyl-3-[4-[4-(4-methylphenyl)cyclohexyl]cyclohexyl]hex-2-enoic acid (PubChem CID 70004413) has the molecular formula C26H38O2 and a molecular weight of 382.59 g/mol. Its IUPAC name is 2-methyl-3-[4-[4-(4-methylphenyl)cyclohexyl]cyclohexyl]hex-2-enoic acid.
| Compound Name | 2-methyl-3-[4-[4-(4-methylphenyl)cyclohexyl]cyclohexyl]hex-2-enoic acid |
|---|---|
| PubChem CID | 70004413 |
| Molecular Formula | C26H38O2 |
| Molecular Weight | 382.59 g/mol |
| Exact Mass | 382.29 |
| IUPAC Name | 2-methyl-3-[4-[4-(4-methylphenyl)cyclohexyl]cyclohexyl]hex-2-enoic acid |
| SMILES | CCCC(=C(C)C(=O)O)C1CCC(C2CCC(c3ccc(C)cc3)CC2)CC1 |
| InChI | InChI=1S/C26H38O2/c1-4-5-25(19(3)26(27)28)24-16-14-23(15-17-24)22-12-10-21(11-13-22)20-8-6-18(2)7-9-20/h6-9,21-24H,4-5,10-17H2,1-3H3,(H,27,28) |
| InChIKey | UETINEDHFKTYMB-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.59 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|