About [(4-iodophenyl)-phenyl-λ3-iodanyl] trifluoromethanesulfonate
[(4-iodophenyl)-phenyl-λ3-iodanyl] trifluoromethanesulfonate (PubChem CID 15046629) has the molecular formula C13H9F3I2O3S
and a molecular weight of 556.08 g/mol. Its IUPAC name is [(4-iodophenyl)-phenyl-λ3-iodanyl] trifluoromethanesulfonate.
Molecular Properties
| Compound Name | [(4-iodophenyl)-phenyl-λ3-iodanyl] trifluoromethanesulfonate |
| PubChem CID | 15046629 |
| Molecular Formula | C13H9F3I2O3S |
| Molecular Weight | 556.08 g/mol |
| Exact Mass | 555.83 |
| IUPAC Name | [(4-iodophenyl)-phenyl-λ3-iodanyl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(OI(c1ccccc1)c1ccc(I)cc1)C(F)(F)F |
| InChI | InChI=1S/C13H9F3I2O3S/c14-13(15,16)22(19,20)21-18(11-4-2-1-3-5-11)12-8-6-10(17)7-9-12/h1-9H |
| InChIKey | GFVFGXLLPUIAPZ-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 556.08 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze [(4-iodophenyl)-phenyl-λ3-iodanyl] trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4-iodophenyl)-phenyl-λ3-iodanyl] trifluoromethanesulfonate?
The IUPAC name of [(4-iodophenyl)-phenyl-λ3-iodanyl] trifluoromethanesulfonate (CID 15046629) is [(4-iodophenyl)-phenyl-λ3-iodanyl] trifluoromethanesulfonate.
What is the SMILES notation for [(4-iodophenyl)-phenyl-λ3-iodanyl] trifluoromethanesulfonate?
The canonical SMILES for [(4-iodophenyl)-phenyl-λ3-iodanyl] trifluoromethanesulfonate is O=S(=O)(OI(c1ccccc1)c1ccc(I)cc1)C(F)(F)F.
What is the InChIKey of [(4-iodophenyl)-phenyl-λ3-iodanyl] trifluoromethanesulfonate?
The InChIKey is GFVFGXLLPUIAPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9F3I2O3S/c14-13(15,16)22(19,20)21-18(11-4-2-1-3-5-11)12-8-6-10(17)7-9-12/h1-9H.
What are the key properties of [(4-iodophenyl)-phenyl-λ3-iodanyl] trifluoromethanesulfonate?
[(4-iodophenyl)-phenyl-λ3-iodanyl] trifluoromethanesulfonate has a molecular weight of 556.08 g/mol, XLogP of 4.62, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(4-iodophenyl)-phenyl-λ3-iodanyl] trifluoromethanesulfonate is sourced from PubChem (CID 15046629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).