C26H34N2O5 — CID 150471869
(2R,4R)-4-(1,3-benzodioxol-5-yl)-N-(2-butoxyethyl)-2-(4-methoxyphenyl)-N-methylpyrrolidine-1-carboxamide (PubChem CID 150471869) has the molecular formula C26H34N2O5 and a molecular weight of 454.57 g/mol. Its IUPAC name is (2R,4R)-4-(1,3-benzodioxol-5-yl)-N-(2-butoxyethyl)-2-(4-methoxyphenyl)-N-methylpyrrolidine-1-carboxamide.
| Compound Name | (2R,4R)-4-(1,3-benzodioxol-5-yl)-N-(2-butoxyethyl)-2-(4-methoxyphenyl)-N-methylpyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 150471869 |
| Molecular Formula | C26H34N2O5 |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.25 |
| IUPAC Name | (2R,4R)-4-(1,3-benzodioxol-5-yl)-N-(2-butoxyethyl)-2-(4-methoxyphenyl)-N-methylpyrrolidine-1-carboxamide |
| SMILES | CCCCOCCN(C)C(=O)N1C[C@@H](c2ccc3c(c2)OCO3)C[C@@H]1c1ccc(OC)cc1 |
| InChI | InChI=1S/C26H34N2O5/c1-4-5-13-31-14-12-27(2)26(29)28-17-21(20-8-11-24-25(16-20)33-18-32-24)15-23(28)19-6-9-22(30-3)10-7-19/h6-11,16,21,23H,4-5,12-15,17-18H2,1-3H3/t21-,23+/m0/s1 |
| InChIKey | HRYRYPAIEMZEGK-JTHBVZDNSA-N |
| XLogP | 4.82 |
| TPSA | 60.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|