About 1H-isoquinolin-2-yl benzenesulfonate
1H-isoquinolin-2-yl benzenesulfonate (PubChem CID 150481965) has the molecular formula C15H13NO3S
and a molecular weight of 287.34 g/mol. Its IUPAC name is 1H-isoquinolin-2-yl benzenesulfonate.
Molecular Properties
| Compound Name | 1H-isoquinolin-2-yl benzenesulfonate |
| PubChem CID | 150481965 |
| Molecular Formula | C15H13NO3S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | 1H-isoquinolin-2-yl benzenesulfonate |
| SMILES | O=S(=O)(ON1C=Cc2ccccc2C1)c1ccccc1 |
| InChI | InChI=1S/C15H13NO3S/c17-20(18,15-8-2-1-3-9-15)19-16-11-10-13-6-4-5-7-14(13)12-16/h1-11H,12H2 |
| InChIKey | HTZUEDMUTLVKPG-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1H-isoquinolin-2-yl benzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-isoquinolin-2-yl benzenesulfonate?
The IUPAC name of 1H-isoquinolin-2-yl benzenesulfonate (CID 150481965) is 1H-isoquinolin-2-yl benzenesulfonate.
What is the SMILES notation for 1H-isoquinolin-2-yl benzenesulfonate?
The canonical SMILES for 1H-isoquinolin-2-yl benzenesulfonate is O=S(=O)(ON1C=Cc2ccccc2C1)c1ccccc1.
What is the InChIKey of 1H-isoquinolin-2-yl benzenesulfonate?
The InChIKey is HTZUEDMUTLVKPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13NO3S/c17-20(18,15-8-2-1-3-9-15)19-16-11-10-13-6-4-5-7-14(13)12-16/h1-11H,12H2.
What are the key properties of 1H-isoquinolin-2-yl benzenesulfonate?
1H-isoquinolin-2-yl benzenesulfonate has a molecular weight of 287.34 g/mol, XLogP of 2.79, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-isoquinolin-2-yl benzenesulfonate is sourced from PubChem (CID 150481965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).