About (2-amino-1H-imidazo[4,5-b]pyridin-6-yl)-phenylmethanone
(2-amino-1H-imidazo[4,5-b]pyridin-6-yl)-phenylmethanone (PubChem CID 15048566) has the molecular formula C13H10N4O
and a molecular weight of 238.25 g/mol. Its IUPAC name is (2-amino-1H-imidazo[4,5-b]pyridin-6-yl)-phenylmethanone.
Molecular Properties
| Compound Name | (2-amino-1H-imidazo[4,5-b]pyridin-6-yl)-phenylmethanone |
| PubChem CID | 15048566 |
| Molecular Formula | C13H10N4O |
| Molecular Weight | 238.25 g/mol |
| Exact Mass | 238.09 |
| IUPAC Name | (2-amino-1H-imidazo[4,5-b]pyridin-6-yl)-phenylmethanone |
| SMILES | Nc1nc2ncc(C(=O)c3ccccc3)cc2[nH]1 |
| InChI | InChI=1S/C13H10N4O/c14-13-16-10-6-9(7-15-12(10)17-13)11(18)8-4-2-1-3-5-8/h1-7H,(H3,14,15,16,17) |
| InChIKey | MQAUOKDHNDFPIK-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.25 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2-amino-1H-imidazo[4,5-b]pyridin-6-yl)-phenylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-amino-1H-imidazo[4,5-b]pyridin-6-yl)-phenylmethanone?
The IUPAC name of (2-amino-1H-imidazo[4,5-b]pyridin-6-yl)-phenylmethanone (CID 15048566) is (2-amino-1H-imidazo[4,5-b]pyridin-6-yl)-phenylmethanone.
What is the SMILES notation for (2-amino-1H-imidazo[4,5-b]pyridin-6-yl)-phenylmethanone?
The canonical SMILES for (2-amino-1H-imidazo[4,5-b]pyridin-6-yl)-phenylmethanone is Nc1nc2ncc(C(=O)c3ccccc3)cc2[nH]1.
What is the InChIKey of (2-amino-1H-imidazo[4,5-b]pyridin-6-yl)-phenylmethanone?
The InChIKey is MQAUOKDHNDFPIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10N4O/c14-13-16-10-6-9(7-15-12(10)17-13)11(18)8-4-2-1-3-5-8/h1-7H,(H3,14,15,16,17).
What are the key properties of (2-amino-1H-imidazo[4,5-b]pyridin-6-yl)-phenylmethanone?
(2-amino-1H-imidazo[4,5-b]pyridin-6-yl)-phenylmethanone has a molecular weight of 238.25 g/mol, XLogP of 1.77, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-amino-1H-imidazo[4,5-b]pyridin-6-yl)-phenylmethanone is sourced from PubChem (CID 15048566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).