C10H17Cl2NO2 — CID 150486044
2,2-dichloro-1-(5-ethoxy-2,2-dimethylpyrrolidin-1-yl)ethanone (PubChem CID 150486044) has the molecular formula C10H17Cl2NO2 and a molecular weight of 254.16 g/mol. Its IUPAC name is 2,2-dichloro-1-(5-ethoxy-2,2-dimethylpyrrolidin-1-yl)ethanone.
| Compound Name | 2,2-dichloro-1-(5-ethoxy-2,2-dimethylpyrrolidin-1-yl)ethanone |
|---|---|
| PubChem CID | 150486044 |
| Molecular Formula | C10H17Cl2NO2 |
| Molecular Weight | 254.16 g/mol |
| Exact Mass | 253.06 |
| IUPAC Name | 2,2-dichloro-1-(5-ethoxy-2,2-dimethylpyrrolidin-1-yl)ethanone |
| SMILES | CCOC1CCC(C)(C)N1C(=O)C(Cl)Cl |
| InChI | InChI=1S/C10H17Cl2NO2/c1-4-15-7-5-6-10(2,3)13(7)9(14)8(11)12/h7-8H,4-6H2,1-3H3 |
| InChIKey | HUURVKFAKACHLH-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.16 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|