C13H20Cl2N2O2 — CID 174622744
1-(2,2-dichloroacetyl)-3,3,8a-trimethyl-4,6,7,8-tetrahydro-2H-pyrrolo[1,2-a]pyrimidine-6-carbaldehyde (PubChem CID 174622744) has the molecular formula C13H20Cl2N2O2 and a molecular weight of 307.22 g/mol. Its IUPAC name is 1-(2,2-dichloroacetyl)-3,3,8a-trimethyl-4,6,7,8-tetrahydro-2H-pyrrolo[1,2-a]pyrimidine-6-carbaldehyde.
| Compound Name | 1-(2,2-dichloroacetyl)-3,3,8a-trimethyl-4,6,7,8-tetrahydro-2H-pyrrolo[1,2-a]pyrimidine-6-carbaldehyde |
|---|---|
| PubChem CID | 174622744 |
| Molecular Formula | C13H20Cl2N2O2 |
| Molecular Weight | 307.22 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | 1-(2,2-dichloroacetyl)-3,3,8a-trimethyl-4,6,7,8-tetrahydro-2H-pyrrolo[1,2-a]pyrimidine-6-carbaldehyde |
| SMILES | CC1(C)CN(C(=O)C(Cl)Cl)C2(C)CCC(C=O)N2C1 |
| InChI | InChI=1S/C13H20Cl2N2O2/c1-12(2)7-16-9(6-18)4-5-13(16,3)17(8-12)11(19)10(14)15/h6,9-10H,4-5,7-8H2,1-3H3 |
| InChIKey | DVFSHIXNWISAFO-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.22 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|