C17H27Cl2NOS — CID 57158208
2,2-dichloro-1-(5,9-dimethyl-7-thia-14-azadispiro[5.1.58.26]pentadecan-14-yl)ethanone (PubChem CID 57158208) has the molecular formula C17H27Cl2NOS and a molecular weight of 364.38 g/mol. Its IUPAC name is 2,2-dichloro-1-(5,9-dimethyl-7-thia-14-azadispiro[5.1.58.26]pentadecan-14-yl)ethanone.
| Compound Name | 2,2-dichloro-1-(5,9-dimethyl-7-thia-14-azadispiro[5.1.58.26]pentadecan-14-yl)ethanone |
|---|---|
| PubChem CID | 57158208 |
| Molecular Formula | C17H27Cl2NOS |
| Molecular Weight | 364.38 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | 2,2-dichloro-1-(5,9-dimethyl-7-thia-14-azadispiro[5.1.58.26]pentadecan-14-yl)ethanone |
| SMILES | CC1CCCCC12CN(C(=O)C(Cl)Cl)C1(CCCCC1C)S2 |
| InChI | InChI=1S/C17H27Cl2NOS/c1-12-7-3-5-9-16(12)11-20(15(21)14(18)19)17(22-16)10-6-4-8-13(17)2/h12-14H,3-11H2,1-2H3 |
| InChIKey | UDRJITDIZJTTDP-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.38 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|