C22H28BrN3 — CID 150493471
1-[[2-[(2R)-1-(4-bromophenyl)pyrrolidin-2-yl]phenyl]methyl]-4-methylpiperazine (PubChem CID 150493471) has the molecular formula C22H28BrN3 and a molecular weight of 414.39 g/mol. Its IUPAC name is 1-[[2-[(2R)-1-(4-bromophenyl)pyrrolidin-2-yl]phenyl]methyl]-4-methylpiperazine.
| Compound Name | 1-[[2-[(2R)-1-(4-bromophenyl)pyrrolidin-2-yl]phenyl]methyl]-4-methylpiperazine |
|---|---|
| PubChem CID | 150493471 |
| Molecular Formula | C22H28BrN3 |
| Molecular Weight | 414.39 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | 1-[[2-[(2R)-1-(4-bromophenyl)pyrrolidin-2-yl]phenyl]methyl]-4-methylpiperazine |
| SMILES | CN1CCN(Cc2ccccc2[C@H]2CCCN2c2ccc(Br)cc2)CC1 |
| InChI | InChI=1S/C22H28BrN3/c1-24-13-15-25(16-14-24)17-18-5-2-3-6-21(18)22-7-4-12-26(22)20-10-8-19(23)9-11-20/h2-3,5-6,8-11,22H,4,7,12-17H2,1H3/t22-/m1/s1 |
| InChIKey | HWHBCENCQOTTOY-JOCHJYFZSA-N |
| XLogP | 4.54 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.39 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |