C17H17N5O3 — CID 15049810
4-[(E)-2-[3-[(2E)-2-(diaminomethylidenehydrazinylidene)ethoxy]-2-pyridinyl]ethenyl]benzoic acid (PubChem CID 15049810) has the molecular formula C17H17N5O3 and a molecular weight of 339.36 g/mol. Its IUPAC name is 4-[(E)-2-[3-[(2E)-2-(diaminomethylidenehydrazinylidene)ethoxy]-2-pyridinyl]ethenyl]benzoic acid.
| Compound Name | 4-[(E)-2-[3-[(2E)-2-(diaminomethylidenehydrazinylidene)ethoxy]-2-pyridinyl]ethenyl]benzoic acid |
|---|---|
| PubChem CID | 15049810 |
| Molecular Formula | C17H17N5O3 |
| Molecular Weight | 339.36 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | 4-[(E)-2-[3-[(2E)-2-(diaminomethylidenehydrazinylidene)ethoxy]-2-pyridinyl]ethenyl]benzoic acid |
| SMILES | NC(N)=N/N=C/COc1cccnc1/C=C/c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C17H17N5O3/c18-17(19)22-21-10-11-25-15-2-1-9-20-14(15)8-5-12-3-6-13(7-4-12)16(23)24/h1-10H,11H2,(H,23,24)(H4,18,19,22)/b8-5+,21-10+ |
| InChIKey | WPAAWEYHSUSZIN-OCJNCHRHSA-N |
| XLogP | 1.59 |
| TPSA | 136.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.36 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|