C15H20N2O7 — CID 150509300
[[(2S)-3-hydroxy-2-phenylmethoxypropanoyl]-[(2R)-1-methoxy-1-oxopropan-2-yl]amino]carbamic acid (PubChem CID 150509300) has the molecular formula C15H20N2O7 and a molecular weight of 340.33 g/mol. Its IUPAC name is [[(2S)-3-hydroxy-2-phenylmethoxypropanoyl]-[(2R)-1-methoxy-1-oxopropan-2-yl]amino]carbamic acid.
| Compound Name | [[(2S)-3-hydroxy-2-phenylmethoxypropanoyl]-[(2R)-1-methoxy-1-oxopropan-2-yl]amino]carbamic acid |
|---|---|
| PubChem CID | 150509300 |
| Molecular Formula | C15H20N2O7 |
| Molecular Weight | 340.33 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | [[(2S)-3-hydroxy-2-phenylmethoxypropanoyl]-[(2R)-1-methoxy-1-oxopropan-2-yl]amino]carbamic acid |
| SMILES | COC(=O)[C@@H](C)N(NC(=O)O)C(=O)[C@H](CO)OCc1ccccc1 |
| InChI | InChI=1S/C15H20N2O7/c1-10(14(20)23-2)17(16-15(21)22)13(19)12(8-18)24-9-11-6-4-3-5-7-11/h3-7,10,12,16,18H,8-9H2,1-2H3,(H,21,22)/t10-,12+/m1/s1 |
| InChIKey | HZMNXQBYMKGLQI-PWSUYJOCSA-N |
| XLogP | 0.14 |
| TPSA | 125.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.33 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|