C12H14N4S3 — CID 15050987
1,1-bis(methylsulfanyl)-N-(5-methylsulfanyl-4-phenyl-1,2,4-triazol-3-yl)methanimine (PubChem CID 15050987) has the molecular formula C12H14N4S3 and a molecular weight of 310.47 g/mol. Its IUPAC name is 1,1-bis(methylsulfanyl)-N-(5-methylsulfanyl-4-phenyl-1,2,4-triazol-3-yl)methanimine.
| Compound Name | 1,1-bis(methylsulfanyl)-N-(5-methylsulfanyl-4-phenyl-1,2,4-triazol-3-yl)methanimine |
|---|---|
| PubChem CID | 15050987 |
| Molecular Formula | C12H14N4S3 |
| Molecular Weight | 310.47 g/mol |
| Exact Mass | 310.04 |
| IUPAC Name | 1,1-bis(methylsulfanyl)-N-(5-methylsulfanyl-4-phenyl-1,2,4-triazol-3-yl)methanimine |
| SMILES | CSC(=Nc1nnc(SC)n1-c1ccccc1)SC |
| InChI | InChI=1S/C12H14N4S3/c1-17-11-15-14-10(13-12(18-2)19-3)16(11)9-7-5-4-6-8-9/h4-8H,1-3H3 |
| InChIKey | UPENJFZFYRJMBB-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 43.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.47 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|