C21H15N3O3 — CID 150530544
3-azido-2-(2-oxo-1,2-diphenylethyl)benzoic acid (PubChem CID 150530544) has the molecular formula C21H15N3O3 and a molecular weight of 357.37 g/mol. Its IUPAC name is 3-azido-2-(2-oxo-1,2-diphenylethyl)benzoic acid.
| Compound Name | 3-azido-2-(2-oxo-1,2-diphenylethyl)benzoic acid |
|---|---|
| PubChem CID | 150530544 |
| Molecular Formula | C21H15N3O3 |
| Molecular Weight | 357.37 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | 3-azido-2-(2-oxo-1,2-diphenylethyl)benzoic acid |
| SMILES | [N-]=[N+]=Nc1cccc(C(=O)O)c1C(C(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H15N3O3/c22-24-23-17-13-7-12-16(21(26)27)19(17)18(14-8-3-1-4-9-14)20(25)15-10-5-2-6-11-15/h1-13,18H,(H,26,27) |
| InChIKey | IDSWMVMXFDDARU-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 103.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.37 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|