About 1-phenyl-2,2-bis(4-phenyldiazenylphenyl)ethanone
1-phenyl-2,2-bis(4-phenyldiazenylphenyl)ethanone (PubChem CID 174554384) has the molecular formula C32H24N4O
and a molecular weight of 480.57 g/mol. Its IUPAC name is 1-phenyl-2,2-bis(4-phenyldiazenylphenyl)ethanone.
Molecular Properties
| Compound Name | 1-phenyl-2,2-bis(4-phenyldiazenylphenyl)ethanone |
| PubChem CID | 174554384 |
| Molecular Formula | C32H24N4O |
| Molecular Weight | 480.57 g/mol |
| Exact Mass | 480.20 |
| IUPAC Name | 1-phenyl-2,2-bis(4-phenyldiazenylphenyl)ethanone |
| SMILES | O=C(c1ccccc1)C(c1ccc(/N=N/c2ccccc2)cc1)c1ccc(/N=N/c2ccccc2)cc1 |
| InChI | InChI=1S/C32H24N4O/c37-32(26-10-4-1-5-11-26)31(24-16-20-29(21-17-24)35-33-27-12-6-2-7-13-27)25-18-22-30(23-19-25)36-34-28-14-8-3-9-15-28/h1-23,31H/b35-33+,36-34+ |
| InChIKey | BJRPIZXEZVBYJA-LBYUQGKWSA-N |
| XLogP | 9.53 |
| TPSA | 66.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 480.57 |
| LogP ≤ 5 | 9.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 1-phenyl-2,2-bis(4-phenyldiazenylphenyl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenyl-2,2-bis(4-phenyldiazenylphenyl)ethanone?
The IUPAC name of 1-phenyl-2,2-bis(4-phenyldiazenylphenyl)ethanone (CID 174554384) is 1-phenyl-2,2-bis(4-phenyldiazenylphenyl)ethanone.
What is the SMILES notation for 1-phenyl-2,2-bis(4-phenyldiazenylphenyl)ethanone?
The canonical SMILES for 1-phenyl-2,2-bis(4-phenyldiazenylphenyl)ethanone is O=C(c1ccccc1)C(c1ccc(/N=N/c2ccccc2)cc1)c1ccc(/N=N/c2ccccc2)cc1.
What is the InChIKey of 1-phenyl-2,2-bis(4-phenyldiazenylphenyl)ethanone?
The InChIKey is BJRPIZXEZVBYJA-LBYUQGKWSA-N. The full InChI is InChI=1S/C32H24N4O/c37-32(26-10-4-1-5-11-26)31(24-16-20-29(21-17-24)35-33-27-12-6-2-7-13-27)25-18-22-30(23-19-25)36-34-28-14-8-3-9-15-28/h1-23,31H/b35-33+,36-34+.
What are the key properties of 1-phenyl-2,2-bis(4-phenyldiazenylphenyl)ethanone?
1-phenyl-2,2-bis(4-phenyldiazenylphenyl)ethanone has a molecular weight of 480.57 g/mol, XLogP of 9.53, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenyl-2,2-bis(4-phenyldiazenylphenyl)ethanone is sourced from PubChem (CID 174554384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).