C20H40O3 — CID 150535991
9-ethyl-15,15,15-trimethoxypentadec-7-ene (PubChem CID 150535991) has the molecular formula C20H40O3 and a molecular weight of 328.54 g/mol. Its IUPAC name is 9-ethyl-15,15,15-trimethoxypentadec-7-ene.
| Compound Name | 9-ethyl-15,15,15-trimethoxypentadec-7-ene |
|---|---|
| PubChem CID | 150535991 |
| Molecular Formula | C20H40O3 |
| Molecular Weight | 328.54 g/mol |
| Exact Mass | 328.30 |
| IUPAC Name | 9-ethyl-15,15,15-trimethoxypentadec-7-ene |
| SMILES | CCCCCCC=CC(CC)CCCCCC(OC)(OC)OC |
| InChI | InChI=1S/C20H40O3/c1-6-8-9-10-11-13-16-19(7-2)17-14-12-15-18-20(21-3,22-4)23-5/h13,16,19H,6-12,14-15,17-18H2,1-5H3 |
| InChIKey | IEVXNURGWNFWRD-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.54 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|