C19H38O3 — CID 151277157
7-(4,4,4-trimethoxybutyl)dodec-5-ene (PubChem CID 151277157) has the molecular formula C19H38O3 and a molecular weight of 314.51 g/mol. Its IUPAC name is 7-(4,4,4-trimethoxybutyl)dodec-5-ene.
| Compound Name | 7-(4,4,4-trimethoxybutyl)dodec-5-ene |
|---|---|
| PubChem CID | 151277157 |
| Molecular Formula | C19H38O3 |
| Molecular Weight | 314.51 g/mol |
| Exact Mass | 314.28 |
| IUPAC Name | 7-(4,4,4-trimethoxybutyl)dodec-5-ene |
| SMILES | CCCCC=CC(CCCCC)CCCC(OC)(OC)OC |
| InChI | InChI=1S/C19H38O3/c1-6-8-10-12-15-18(14-11-9-7-2)16-13-17-19(20-3,21-4)22-5/h12,15,18H,6-11,13-14,16-17H2,1-5H3 |
| InChIKey | NXPBROUAWSUHTF-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.51 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|