C17H23N3O3S3 — CID 15053664
2-[(5Z)-5-[[2-(octylamino)-1,3-thiazol-4-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid (PubChem CID 15053664) has the molecular formula C17H23N3O3S3 and a molecular weight of 413.59 g/mol. Its IUPAC name is 2-[(5Z)-5-[[2-(octylamino)-1,3-thiazol-4-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid.
| Compound Name | 2-[(5Z)-5-[[2-(octylamino)-1,3-thiazol-4-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 15053664 |
| Molecular Formula | C17H23N3O3S3 |
| Molecular Weight | 413.59 g/mol |
| Exact Mass | 413.09 |
| IUPAC Name | 2-[(5Z)-5-[[2-(octylamino)-1,3-thiazol-4-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid |
| SMILES | CCCCCCCCNc1nc(/C=C2\SC(=S)N(CC(=O)O)C2=O)cs1 |
| InChI | InChI=1S/C17H23N3O3S3/c1-2-3-4-5-6-7-8-18-16-19-12(11-25-16)9-13-15(23)20(10-14(21)22)17(24)26-13/h9,11H,2-8,10H2,1H3,(H,18,19)(H,21,22)/b13-9- |
| InChIKey | FKYJVWQJSJIMED-LCYFTJDESA-N |
| XLogP | 4.20 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.59 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|