C9H7N3O4S2 — CID 15053673
2-[(5Z)-5-[(2-amino-1,3-thiazol-4-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid (PubChem CID 15053673) has the molecular formula C9H7N3O4S2 and a molecular weight of 285.31 g/mol. Its IUPAC name is 2-[(5Z)-5-[(2-amino-1,3-thiazol-4-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid.
| Compound Name | 2-[(5Z)-5-[(2-amino-1,3-thiazol-4-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 15053673 |
| Molecular Formula | C9H7N3O4S2 |
| Molecular Weight | 285.31 g/mol |
| Exact Mass | 284.99 |
| IUPAC Name | 2-[(5Z)-5-[(2-amino-1,3-thiazol-4-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid |
| SMILES | Nc1nc(/C=C2\SC(=O)N(CC(=O)O)C2=O)cs1 |
| InChI | InChI=1S/C9H7N3O4S2/c10-8-11-4(3-17-8)1-5-7(15)12(2-6(13)14)9(16)18-5/h1,3H,2H2,(H2,10,11)(H,13,14)/b5-1- |
| InChIKey | KRMSBLVPOSJOFP-KTAJNNJTSA-N |
| XLogP | 0.85 |
| TPSA | 113.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.31 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|