C11H10N2O3S — CID 157447882
(5Z)-3-(2-oxopropyl)-5-(3H-pyrrol-5-ylmethylidene)-1,3-thiazolidine-2,4-dione (PubChem CID 157447882) has the molecular formula C11H10N2O3S and a molecular weight of 250.28 g/mol. Its IUPAC name is (5Z)-3-(2-oxopropyl)-5-(3H-pyrrol-5-ylmethylidene)-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-3-(2-oxopropyl)-5-(3H-pyrrol-5-ylmethylidene)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 157447882 |
| Molecular Formula | C11H10N2O3S |
| Molecular Weight | 250.28 g/mol |
| Exact Mass | 250.04 |
| IUPAC Name | (5Z)-3-(2-oxopropyl)-5-(3H-pyrrol-5-ylmethylidene)-1,3-thiazolidine-2,4-dione |
| SMILES | CC(=O)CN1C(=O)S/C(=C\C2=CCC=N2)C1=O |
| InChI | InChI=1S/C11H10N2O3S/c1-7(14)6-13-10(15)9(17-11(13)16)5-8-3-2-4-12-8/h3-5H,2,6H2,1H3/b9-5- |
| InChIKey | HVGOWMVMUXUJLO-UITAMQMPSA-N |
| XLogP | 1.51 |
| TPSA | 66.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.28 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|