C18H18N2O2S2 — CID 139217932
(5Z)-3-pentyl-5-[(2-phenyl-1,3-thiazol-4-yl)methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 139217932) has the molecular formula C18H18N2O2S2 and a molecular weight of 358.49 g/mol. Its IUPAC name is (5Z)-3-pentyl-5-[(2-phenyl-1,3-thiazol-4-yl)methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-3-pentyl-5-[(2-phenyl-1,3-thiazol-4-yl)methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 139217932 |
| Molecular Formula | C18H18N2O2S2 |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.08 |
| IUPAC Name | (5Z)-3-pentyl-5-[(2-phenyl-1,3-thiazol-4-yl)methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | CCCCCN1C(=O)S/C(=C\c2csc(-c3ccccc3)n2)C1=O |
| InChI | InChI=1S/C18H18N2O2S2/c1-2-3-7-10-20-17(21)15(24-18(20)22)11-14-12-23-16(19-14)13-8-5-4-6-9-13/h4-6,8-9,11-12H,2-3,7,10H2,1H3/b15-11- |
| InChIKey | LFJXVQXJZQEVLW-PTNGSMBKSA-N |
| XLogP | 5.04 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|