C14H26N2S — CID 150538559
4-(1-butylpiperidin-4-yl)-2,3-dimethyl-2H-1,3-thiazole (PubChem CID 150538559) has the molecular formula C14H26N2S and a molecular weight of 254.44 g/mol. Its IUPAC name is 4-(1-butylpiperidin-4-yl)-2,3-dimethyl-2H-1,3-thiazole.
| Compound Name | 4-(1-butylpiperidin-4-yl)-2,3-dimethyl-2H-1,3-thiazole |
|---|---|
| PubChem CID | 150538559 |
| Molecular Formula | C14H26N2S |
| Molecular Weight | 254.44 g/mol |
| Exact Mass | 254.18 |
| IUPAC Name | 4-(1-butylpiperidin-4-yl)-2,3-dimethyl-2H-1,3-thiazole |
| SMILES | CCCCN1CCC(C2=CSC(C)N2C)CC1 |
| InChI | InChI=1S/C14H26N2S/c1-4-5-8-16-9-6-13(7-10-16)14-11-17-12(2)15(14)3/h11-13H,4-10H2,1-3H3 |
| InChIKey | IFJMZZFGCIYZQO-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.44 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |