C10H18N2S — CID 143328728
2,3-dimethyl-4-piperidin-3-yl-2H-1,3-thiazole (PubChem CID 143328728) has the molecular formula C10H18N2S and a molecular weight of 198.33 g/mol. Its IUPAC name is 2,3-dimethyl-4-piperidin-3-yl-2H-1,3-thiazole.
| Compound Name | 2,3-dimethyl-4-piperidin-3-yl-2H-1,3-thiazole |
|---|---|
| PubChem CID | 143328728 |
| Molecular Formula | C10H18N2S |
| Molecular Weight | 198.33 g/mol |
| Exact Mass | 198.12 |
| IUPAC Name | 2,3-dimethyl-4-piperidin-3-yl-2H-1,3-thiazole |
| SMILES | CC1SC=C(C2CCCNC2)N1C |
| InChI | InChI=1S/C10H18N2S/c1-8-12(2)10(7-13-8)9-4-3-5-11-6-9/h7-9,11H,3-6H2,1-2H3 |
| InChIKey | SPBPSYAOVOOYST-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.33 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |