C9H14N2OS — CID 116966137
4-(1-methylpiperidin-3-yl)-3H-1,3-thiazol-2-one (PubChem CID 116966137) has the molecular formula C9H14N2OS and a molecular weight of 198.29 g/mol. Its IUPAC name is 4-(1-methylpiperidin-3-yl)-3H-1,3-thiazol-2-one.
| Compound Name | 4-(1-methylpiperidin-3-yl)-3H-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 116966137 |
| Molecular Formula | C9H14N2OS |
| Molecular Weight | 198.29 g/mol |
| Exact Mass | 198.08 |
| IUPAC Name | 4-(1-methylpiperidin-3-yl)-3H-1,3-thiazol-2-one |
| SMILES | CN1CCCC(c2csc(=O)[nH]2)C1 |
| InChI | InChI=1S/C9H14N2OS/c1-11-4-2-3-7(5-11)8-6-13-9(12)10-8/h6-7H,2-5H2,1H3,(H,10,12) |
| InChIKey | HTITYCRMDKDOPK-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.29 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |