C17H24O4S — CID 15054086
diethyl 2-[(E)-6-thiophen-2-ylhex-2-enyl]propanedioate (PubChem CID 15054086) has the molecular formula C17H24O4S and a molecular weight of 324.44 g/mol. Its IUPAC name is diethyl 2-[(E)-6-thiophen-2-ylhex-2-enyl]propanedioate.
| Compound Name | diethyl 2-[(E)-6-thiophen-2-ylhex-2-enyl]propanedioate |
|---|---|
| PubChem CID | 15054086 |
| Molecular Formula | C17H24O4S |
| Molecular Weight | 324.44 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | diethyl 2-[(E)-6-thiophen-2-ylhex-2-enyl]propanedioate |
| SMILES | CCOC(=O)C(C/C=C/CCCc1cccs1)C(=O)OCC |
| InChI | InChI=1S/C17H24O4S/c1-3-20-16(18)15(17(19)21-4-2)12-8-6-5-7-10-14-11-9-13-22-14/h6,8-9,11,13,15H,3-5,7,10,12H2,1-2H3/b8-6+ |
| InChIKey | DJYBJFVVURLKTF-SOFGYWHQSA-N |
| XLogP | 3.76 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.44 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|