C22H48O2Zr — CID 150564372
butane;1,1-di(propan-2-yloxy)butane;zirconium(4+) (PubChem CID 150564372) has the molecular formula C22H48O2Zr and a molecular weight of 435.85 g/mol. Its IUPAC name is butane;1,1-di(propan-2-yloxy)butane;zirconium(4+).
| Compound Name | butane;1,1-di(propan-2-yloxy)butane;zirconium(4+) |
|---|---|
| PubChem CID | 150564372 |
| Molecular Formula | C22H48O2Zr |
| Molecular Weight | 435.85 g/mol |
| Exact Mass | 434.27 |
| IUPAC Name | butane;1,1-di(propan-2-yloxy)butane;zirconium(4+) |
| SMILES | [CH2-]CCC.[CH2-]CCC.[CH2-]CCC.[CH2-]CCC(OC(C)C)OC(C)C.[Zr+4] |
| InChI | InChI=1S/C10H21O2.3C4H9.Zr/c1-6-7-10(11-8(2)3)12-9(4)5;3*1-3-4-2;/h8-10H,1,6-7H2,2-5H3;3*1,3-4H2,2H3;/q4*-1;+4 |
| InChIKey | IKNJKISTGKTFKJ-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.85 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|