C27H27FN4O — CID 150574501
1-benzyl-5-[3-fluoro-5-(piperidin-1-ylmethyl)phenyl]indazole-3-carboxamide (PubChem CID 150574501) has the molecular formula C27H27FN4O and a molecular weight of 442.54 g/mol. Its IUPAC name is 1-benzyl-5-[3-fluoro-5-(piperidin-1-ylmethyl)phenyl]indazole-3-carboxamide.
| Compound Name | 1-benzyl-5-[3-fluoro-5-(piperidin-1-ylmethyl)phenyl]indazole-3-carboxamide |
|---|---|
| PubChem CID | 150574501 |
| Molecular Formula | C27H27FN4O |
| Molecular Weight | 442.54 g/mol |
| Exact Mass | 442.22 |
| IUPAC Name | 1-benzyl-5-[3-fluoro-5-(piperidin-1-ylmethyl)phenyl]indazole-3-carboxamide |
| SMILES | NC(=O)c1nn(Cc2ccccc2)c2ccc(-c3cc(F)cc(CN4CCCCC4)c3)cc12 |
| InChI | InChI=1S/C27H27FN4O/c28-23-14-20(17-31-11-5-2-6-12-31)13-22(15-23)21-9-10-25-24(16-21)26(27(29)33)30-32(25)18-19-7-3-1-4-8-19/h1,3-4,7-10,13-16H,2,5-6,11-12,17-18H2,(H2,29,33) |
| InChIKey | IMNGLAVBZSINRM-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.54 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |