C25H31N5O — CID 175327408
1-cyclohexyl-5-[5-(piperidin-1-ylmethyl)-3-pyridinyl]indazole-3-carboxamide (PubChem CID 175327408) has the molecular formula C25H31N5O and a molecular weight of 417.56 g/mol. Its IUPAC name is 1-cyclohexyl-5-[5-(piperidin-1-ylmethyl)-3-pyridinyl]indazole-3-carboxamide.
| Compound Name | 1-cyclohexyl-5-[5-(piperidin-1-ylmethyl)-3-pyridinyl]indazole-3-carboxamide |
|---|---|
| PubChem CID | 175327408 |
| Molecular Formula | C25H31N5O |
| Molecular Weight | 417.56 g/mol |
| Exact Mass | 417.25 |
| IUPAC Name | 1-cyclohexyl-5-[5-(piperidin-1-ylmethyl)-3-pyridinyl]indazole-3-carboxamide |
| SMILES | NC(=O)c1nn(C2CCCCC2)c2ccc(-c3cncc(CN4CCCCC4)c3)cc12 |
| InChI | InChI=1S/C25H31N5O/c26-25(31)24-22-14-19(9-10-23(22)30(28-24)21-7-3-1-4-8-21)20-13-18(15-27-16-20)17-29-11-5-2-6-12-29/h9-10,13-16,21H,1-8,11-12,17H2,(H2,26,31) |
| InChIKey | COAZUDOLRCHXJP-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.56 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |