C20H23N5O — CID 174835336
1-cyclobutyl-5-[5-[(dimethylamino)methyl]-3-pyridinyl]indazole-3-carboxamide (PubChem CID 174835336) has the molecular formula C20H23N5O and a molecular weight of 349.44 g/mol. Its IUPAC name is 1-cyclobutyl-5-[5-[(dimethylamino)methyl]-3-pyridinyl]indazole-3-carboxamide.
| Compound Name | 1-cyclobutyl-5-[5-[(dimethylamino)methyl]-3-pyridinyl]indazole-3-carboxamide |
|---|---|
| PubChem CID | 174835336 |
| Molecular Formula | C20H23N5O |
| Molecular Weight | 349.44 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | 1-cyclobutyl-5-[5-[(dimethylamino)methyl]-3-pyridinyl]indazole-3-carboxamide |
| SMILES | CN(C)Cc1cncc(-c2ccc3c(c2)c(C(N)=O)nn3C2CCC2)c1 |
| InChI | InChI=1S/C20H23N5O/c1-24(2)12-13-8-15(11-22-10-13)14-6-7-18-17(9-14)19(20(21)26)23-25(18)16-4-3-5-16/h6-11,16H,3-5,12H2,1-2H3,(H2,21,26) |
| InChIKey | WIEGSTFKYXWYGH-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.44 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |