C20H30O5S — CID 150593575
2-(cyclopropylmethoxy)-5-nonylsulfonylbenzoic acid (PubChem CID 150593575) has the molecular formula C20H30O5S and a molecular weight of 382.52 g/mol. Its IUPAC name is 2-(cyclopropylmethoxy)-5-nonylsulfonylbenzoic acid.
| Compound Name | 2-(cyclopropylmethoxy)-5-nonylsulfonylbenzoic acid |
|---|---|
| PubChem CID | 150593575 |
| Molecular Formula | C20H30O5S |
| Molecular Weight | 382.52 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | 2-(cyclopropylmethoxy)-5-nonylsulfonylbenzoic acid |
| SMILES | CCCCCCCCCS(=O)(=O)c1ccc(OCC2CC2)c(C(=O)O)c1 |
| InChI | InChI=1S/C20H30O5S/c1-2-3-4-5-6-7-8-13-26(23,24)17-11-12-19(18(14-17)20(21)22)25-15-16-9-10-16/h11-12,14,16H,2-10,13,15H2,1H3,(H,21,22) |
| InChIKey | IQJOMOARVTWKPV-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.52 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|