C26H37N2NaO5S — CID 173456724
sodium;4-[[4-(cyclopropylmethoxy)-3-decoxyphenyl]diazenyl]benzenesulfonic acid;hydride (PubChem CID 173456724) has the molecular formula C26H37N2NaO5S and a molecular weight of 512.65 g/mol. Its IUPAC name is sodium;4-[[4-(cyclopropylmethoxy)-3-decoxyphenyl]diazenyl]benzenesulfonic acid;hydride.
| Compound Name | sodium;4-[[4-(cyclopropylmethoxy)-3-decoxyphenyl]diazenyl]benzenesulfonic acid;hydride |
|---|---|
| PubChem CID | 173456724 |
| Molecular Formula | C26H37N2NaO5S |
| Molecular Weight | 512.65 g/mol |
| Exact Mass | 512.23 |
| IUPAC Name | sodium;4-[[4-(cyclopropylmethoxy)-3-decoxyphenyl]diazenyl]benzenesulfonic acid;hydride |
| SMILES | CCCCCCCCCCOc1cc(/N=N/c2ccc(S(=O)(=O)O)cc2)ccc1OCC1CC1.[H-].[Na+] |
| InChI | InChI=1S/C26H36N2O5S.Na.H/c1-2-3-4-5-6-7-8-9-18-32-26-19-23(14-17-25(26)33-20-21-10-11-21)28-27-22-12-15-24(16-13-22)34(29,30)31;;/h12-17,19,21H,2-11,18,20H2,1H3,(H,29,30,31);;/q;+1;-1/b28-27+;; |
| InChIKey | ARXJVOUUTXHGOA-JZYARHMISA-N |
| XLogP | 4.77 |
| TPSA | 97.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.65 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|