C28H43NO6 — CID 154170681
diethyl 2-[[3-(cyclopropylmethoxy)-4-decoxyanilino]methylidene]propanedioate (PubChem CID 154170681) has the molecular formula C28H43NO6 and a molecular weight of 489.65 g/mol. Its IUPAC name is diethyl 2-[[3-(cyclopropylmethoxy)-4-decoxyanilino]methylidene]propanedioate.
| Compound Name | diethyl 2-[[3-(cyclopropylmethoxy)-4-decoxyanilino]methylidene]propanedioate |
|---|---|
| PubChem CID | 154170681 |
| Molecular Formula | C28H43NO6 |
| Molecular Weight | 489.65 g/mol |
| Exact Mass | 489.31 |
| IUPAC Name | diethyl 2-[[3-(cyclopropylmethoxy)-4-decoxyanilino]methylidene]propanedioate |
| SMILES | CCCCCCCCCCOc1ccc(NC=C(C(=O)OCC)C(=O)OCC)cc1OCC1CC1 |
| InChI | InChI=1S/C28H43NO6/c1-4-7-8-9-10-11-12-13-18-34-25-17-16-23(19-26(25)35-21-22-14-15-22)29-20-24(27(30)32-5-2)28(31)33-6-3/h16-17,19-20,22,29H,4-15,18,21H2,1-3H3 |
| InChIKey | LKUVQZIGMJFUHU-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.65 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|