C22H18F2N2O2 — CID 150594045
N-(2,4-difluoro-3-pent-4-ynoxyphenyl)-2-methylquinoline-6-carboxamide (PubChem CID 150594045) has the molecular formula C22H18F2N2O2 and a molecular weight of 380.39 g/mol. Its IUPAC name is N-(2,4-difluoro-3-pent-4-ynoxyphenyl)-2-methylquinoline-6-carboxamide.
| Compound Name | N-(2,4-difluoro-3-pent-4-ynoxyphenyl)-2-methylquinoline-6-carboxamide |
|---|---|
| PubChem CID | 150594045 |
| Molecular Formula | C22H18F2N2O2 |
| Molecular Weight | 380.39 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | N-(2,4-difluoro-3-pent-4-ynoxyphenyl)-2-methylquinoline-6-carboxamide |
| SMILES | C#CCCCOc1c(F)ccc(NC(=O)c2ccc3nc(C)ccc3c2)c1F |
| InChI | InChI=1S/C22H18F2N2O2/c1-3-4-5-12-28-21-17(23)9-11-19(20(21)24)26-22(27)16-8-10-18-15(13-16)7-6-14(2)25-18/h1,6-11,13H,4-5,12H2,2H3,(H,26,27) |
| InChIKey | IQMCKJVRMKSMHJ-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.39 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|