C20H16FN3O — CID 166339302
N-[(5-fluoro-1H-indol-3-yl)methyl]-2-methylquinoline-6-carboxamide (PubChem CID 166339302) has the molecular formula C20H16FN3O and a molecular weight of 333.37 g/mol. Its IUPAC name is N-[(5-fluoro-1H-indol-3-yl)methyl]-2-methylquinoline-6-carboxamide.
| Compound Name | N-[(5-fluoro-1H-indol-3-yl)methyl]-2-methylquinoline-6-carboxamide |
|---|---|
| PubChem CID | 166339302 |
| Molecular Formula | C20H16FN3O |
| Molecular Weight | 333.37 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | N-[(5-fluoro-1H-indol-3-yl)methyl]-2-methylquinoline-6-carboxamide |
| SMILES | Cc1ccc2cc(C(=O)NCc3c[nH]c4ccc(F)cc34)ccc2n1 |
| InChI | InChI=1S/C20H16FN3O/c1-12-2-3-13-8-14(4-6-18(13)24-12)20(25)23-11-15-10-22-19-7-5-16(21)9-17(15)19/h2-10,22H,11H2,1H3,(H,23,25) |
| InChIKey | OUCCEYOZZOIXOJ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.37 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |