C17H18FN5O — CID 167949731
1-(1-cyclopropyl-5-methylpyrazol-3-yl)-3-[(5-fluoro-1H-indol-3-yl)methyl]urea (PubChem CID 167949731) has the molecular formula C17H18FN5O and a molecular weight of 327.36 g/mol. Its IUPAC name is 1-(1-cyclopropyl-5-methylpyrazol-3-yl)-3-[(5-fluoro-1H-indol-3-yl)methyl]urea.
| Compound Name | 1-(1-cyclopropyl-5-methylpyrazol-3-yl)-3-[(5-fluoro-1H-indol-3-yl)methyl]urea |
|---|---|
| PubChem CID | 167949731 |
| Molecular Formula | C17H18FN5O |
| Molecular Weight | 327.36 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | 1-(1-cyclopropyl-5-methylpyrazol-3-yl)-3-[(5-fluoro-1H-indol-3-yl)methyl]urea |
| SMILES | Cc1cc(NC(=O)NCc2c[nH]c3ccc(F)cc23)nn1C1CC1 |
| InChI | InChI=1S/C17H18FN5O/c1-10-6-16(22-23(10)13-3-4-13)21-17(24)20-9-11-8-19-15-5-2-12(18)7-14(11)15/h2,5-8,13,19H,3-4,9H2,1H3,(H2,20,21,22,24) |
| InChIKey | BUGPSSPFPHSKNN-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 74.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.36 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |