C27H40N6O — CID 150594830
1,5-bis(3-aminophenyl)-2,4-bis(4-methylpiperazin-1-yl)pentan-3-one (PubChem CID 150594830) has the molecular formula C27H40N6O and a molecular weight of 464.66 g/mol. Its IUPAC name is 1,5-bis(3-aminophenyl)-2,4-bis(4-methylpiperazin-1-yl)pentan-3-one.
| Compound Name | 1,5-bis(3-aminophenyl)-2,4-bis(4-methylpiperazin-1-yl)pentan-3-one |
|---|---|
| PubChem CID | 150594830 |
| Molecular Formula | C27H40N6O |
| Molecular Weight | 464.66 g/mol |
| Exact Mass | 464.33 |
| IUPAC Name | 1,5-bis(3-aminophenyl)-2,4-bis(4-methylpiperazin-1-yl)pentan-3-one |
| SMILES | CN1CCN(C(Cc2cccc(N)c2)C(=O)C(Cc2cccc(N)c2)N2CCN(C)CC2)CC1 |
| InChI | InChI=1S/C27H40N6O/c1-30-9-13-32(14-10-30)25(19-21-5-3-7-23(28)17-21)27(34)26(33-15-11-31(2)12-16-33)20-22-6-4-8-24(29)18-22/h3-8,17-18,25-26H,9-16,19-20,28-29H2,1-2H3 |
| InChIKey | IQPZNLCFVQJPJD-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 82.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.66 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|