C27H34ClNO4 — CID 150602156
butyl 3-[5-[(2-chloro-6-methylphenyl)methoxy]spiro[2H-1-benzofuran-3,4'-piperidine]-1'-yl]propanoate (PubChem CID 150602156) has the molecular formula C27H34ClNO4 and a molecular weight of 472.03 g/mol. Its IUPAC name is butyl 3-[5-[(2-chloro-6-methylphenyl)methoxy]spiro[2H-1-benzofuran-3,4'-piperidine]-1'-yl]propanoate.
| Compound Name | butyl 3-[5-[(2-chloro-6-methylphenyl)methoxy]spiro[2H-1-benzofuran-3,4'-piperidine]-1'-yl]propanoate |
|---|---|
| PubChem CID | 150602156 |
| Molecular Formula | C27H34ClNO4 |
| Molecular Weight | 472.03 g/mol |
| Exact Mass | 471.22 |
| IUPAC Name | butyl 3-[5-[(2-chloro-6-methylphenyl)methoxy]spiro[2H-1-benzofuran-3,4'-piperidine]-1'-yl]propanoate |
| SMILES | CCCCOC(=O)CCN1CCC2(CC1)COc1ccc(OCc3c(C)cccc3Cl)cc12 |
| InChI | InChI=1S/C27H34ClNO4/c1-3-4-16-31-26(30)10-13-29-14-11-27(12-15-29)19-33-25-9-8-21(17-23(25)27)32-18-22-20(2)6-5-7-24(22)28/h5-9,17H,3-4,10-16,18-19H2,1-2H3 |
| InChIKey | ISCGBDJVTZYQOG-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.03 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|